Created
July 15, 2020 12:09
-
-
Save bbrighttaer/2201afb2e09c47732f78998fb0d046ec to your computer and use it in GitHub Desktop.
Calculates internal diversity of a given set of SMILES.
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| from __future__ import absolute_import, division, print_function, unicode_literals | |
| import numpy as np | |
| import rdkit.Chem as Chem | |
| from rdkit import DataStructs | |
| from rdkit.Chem import AllChem | |
| def verify_sequence(smile): | |
| mol = Chem.MolFromSmiles(smile) | |
| return smile != '' and mol is not None and mol.GetNumAtoms() > 1 | |
| def batch_internal_diversity(smiles): | |
| """ | |
| Calculates internal diversity of the given compounds. | |
| See http://arxiv.org/abs/1708.08227 | |
| :param smiles: | |
| :param set_smiles: | |
| :return: | |
| """ | |
| rand_mols = [Chem.MolFromSmiles(s) for s in smiles] | |
| fps = [AllChem.GetMorganFingerprintAsBitVect(m, 4, nBits=2048) for m in rand_mols] | |
| vals = [bulk_tanimoto_distance(s, fps) if verify_sequence(s) else 0.0 for s in smiles] | |
| return np.mean(vals) | |
| def bulk_tanimoto_distance(smile, fps): | |
| ref_mol = Chem.MolFromSmiles(smile) | |
| ref_fps = AllChem.GetMorganFingerprintAsBitVect(ref_mol, 4, nBits=2048) | |
| dist = DataStructs.BulkTanimotoSimilarity(ref_fps, fps, returnDistance=True) | |
| return dist | |
| if __name__ == '__main__': | |
| comps = ['COc1cc(Cc2ccccc2Cl)ncc1NC(=N)Nc1ccc(C(=O)N=C2NCCN2C)cc1', | |
| 'Oc1ccc2ccccc2c1-c1nc2ccccc2[nH]1', | |
| 'CN(C)CCn1c(Nc2ccccc2)nc2ccc(NC3CCCC3)cc21', | |
| 'CCCCCCCCCCCCCC(=O)N(C(=O)CCCCCCCC(C)C)C(C)C', | |
| 'COc1ccc(-c2ncnc(N3CCCC3C(=O)NC3CCOC3)n2)cc1'] | |
| print(batch_internal_diversity(comps)) |
Sign up for free
to join this conversation on GitHub.
Already have an account?
Sign in to comment