This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| // International Chemical Identifier Regex, by lo sauer - lsauer.com | |
| // Morphine InchI: | |
| var x="InChI=1S/C17H19NO3/c1-18-7-6-17-10-3-5-13(20)16(17)21-15-12(19)4-2-9(14(15)17)8-11(10)18/h2-5,10-11,13,16,19-20H,6-8H2,1H3/t10-,11+,13-,16-,17-/m0/s1" | |
| // applying an organic character-subset | |
| // we could check for the length property, but in case of 0 matches 'null' is returned -> hence !!.. \ generally equal to Boolean(..) | |
| !!x.trim().match(/^((InChI=)?[^J][0-9BCOHNSOPrIFla+\-\(\)\\\/,pqbtmsih]{6,})$/ig) | |
| >true | |
| //generic: | |
| x.trim().match(/^((InChI=)?[^J][0-9a-z+\-\(\)\\\/,]+)$/ig) |